![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 4. Material and Compound Nouns Independent Practice.vtt | 2024-04-13 11:25 | 1.8K | |
| 4. Material and Compound Nouns Independent Practice.mp4 | 2024-04-13 11:36 | 24M | |
| 3. Material and Compound Nouns Short Story.vtt | 2024-04-13 11:27 | 919 | |
| 3. Material and Compound Nouns Short Story.mp4 | 2024-04-13 11:36 | 8.3M | |
| 2. Material and Compound Nouns Guided Practice.vtt | 2024-04-13 11:36 | 2.8K | |
| 2. Material and Compound Nouns Guided Practice.mp4 | 2024-04-13 11:37 | 29M | |
| 1. Material and Compound Nouns Introduction.vtt | 2024-04-13 11:36 | 4.1K | |
| 1. Material and Compound Nouns Introduction.mp4 | 2024-04-13 11:36 | 42M | |
| 1.1 1. [Textbook] Material and compound nouns.pdf.pdf | 2024-04-13 11:36 | 152K | |